The 3-Pyridinecarboxylicacid, 2-hydrazinyl-, hydrochloride (1:1), with the CAS registry number 435342-14-6, is also known as ZINC00103516. This chemical's molecular formula is C₆H₆N₃O₂ and molecular weight is 152.046001. Its IUPAC name is called 2-hydrazinylpyridine-3-carboxylate.

Physical properties of 3-Pyridinecarboxylicacid, 2-hydrazinyl-, hydrochloride (1:1): (1)ACD/LogP: 0.44; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 5; (7)#H bond donors: 4; (8)#Freely Rotating Bonds: 2; (9)Flash Point: 193.6 °C; (10)Enthalpy of Vaporization: 68.21 kJ/mol; (11)Boiling Point: 396.5 °C at 760 mmHg; (12)Vapour Pressure: 5.35E-07 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=C(N=C1)NN)C(=O)[O-]
(2)InChI: InChI=1S/C6H7N3O2/c7-9-5-4(6(10)11)2-1-3-8-5/h1-3H,7H2,(H,8,9)(H,10,11)/p-1
(3)InChIKey: IZCVLYJVVCABBV-UHFFFAOYSA-M