The 3-Pyridinecarboxylicacid, 5-hydroxy-, ethyl ester, with the CAS registry number of 59288-38-9, is also known as Ethyl 5-hydroxynicotinate and 5-Hydroxynicotinicacid ethyl ester. This chemical's molecular formula is C₈H₉NO₃ and molecular weight is 167.162. What's more, its systematic name is called ethyl 5-Hydroxypyridine-3-carboxylate.

Physical properties about 3-Pyridinecarboxylicacid, 5-hydroxy-, ethyl ester are: (1)ACD/LogP: 1.76; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 48.42 Å²; (7)Index of Refraction: 1.541; (8)Molar Refractivity: 42.63 cm³; (9)Molar Volume: 135.4 cm³; (10)Surface Tension: 50.4 dyne/cm; (11)Density: 1.233 g/cm³; (12)Flash Point: 180.8 °C; (13)Enthalpy of Vaporization: 64.73 kJ/mol; (14)Boiling Point: 375.4 °C at 760 mmHg; (15)Vapour Pressure: 3.61E-06 mmHg at 25 °C.

Uses: it is used to produce other chemicals. For example, it is used to produce 5-Hydroxynicotinic acid hydrazide by heating. This reaction needs reagent 50 % Hydrazine hydrate. The reaction time is 1 hour. The yield is about 72 %.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C(OCC)c1cncc(O)c1
(2) InChI: InChI=1/C8H9NO3/c1-2-12-8(11)6-3-7(10)5-9-4-6/h3-5,10H,2H2,1H3
(3) InChIKey: LFDNUOROKFFJLE-UHFFFAOYAU