The 3-Phenoxypyridine, with the CAS registry number 2176-45-6, is also known as Pyridine, 3-phenoxy-. This chemical's molecular formula is C₁₁H₉NO and molecular weight is 171.19. Its IUPAC name is called 3-phenoxypyridine. This chemical's classification code is Drug / Therapeutic Agent.

Physical properties of 3-Phenoxypyridine: (1)ACD/LogP: 2.72; (2)#H bond acceptors: 2; (3)#H bond donors: 0; (4)#Freely Rotating Bonds: 2; (5)Index of Refraction: 1.577; (6)Molar Refractivity: 50.78 cm³; (7)Molar Volume: 153.2 cm³; (8)Surface Tension: 43 dyne/cm; (9)Density: 1.117 g/cm³; (10)Flash Point: 100.6 °C; (11)Enthalpy of Vaporization: 49.22 kJ/mol; (12)Boiling Point: 274.4 °C at 760 mmHg; (13)Vapour Pressure: 0.00906 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C(C=C1)OC2=CN=CC=C2
(2)InChI: InChI=1S/C11H9NO/c1-2-5-10(6-3-1)13-11-7-4-8-12-9-11/h1-9H
(3)InChIKey: KDGUIKPOZGYLQJ-UHFFFAOYSA-N

The toxicity data is as follows: