The CAS registry number of 4,4-Diphenyloxazolidine-2,5-dione is 26314-06-7. This chemical's molecular formula is C₁₅H₁₁NO₃ and molecular weight is 253.2527. What's more, its IUPAC name and systematic name are the same which is called 4,4-Diphenyl-1,3-oxazolidine-2,5-dione.

Physical properties about 4,4-Diphenyloxazolidine-2,5-dione: (1)ACD/LogP: 2.60; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.59; (4)ACD/LogD (pH 7.4): 2.47; (5)ACD/BCF (pH 5.5): 55.17; (6)ACD/BCF (pH 7.4): 40.99; (7)ACD/KOC (pH 5.5): 613.46; (8)ACD/KOC (pH 7.4): 455.75; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 46.61 Å²; (13)Index of Refraction: 1.61; (14)Molar Refractivity: 67.84 cm³; (15)Molar Volume: 195.5 cm³; (16)Surface Tension: 51.2 dyne/cm; (17)Density: 1.294 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C2OC(=O)C(c1ccccc1)(N2)c3ccccc3
(2) InChI: InChI=1/C15H11NO3/c17-13-15(16-14(18)19-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H,16,18)
(3) InChIKey: JEVIEYZRIYPTPK-UHFFFAOYAE