The 4-Decanone,2-methyl-, with the CAS registry number 6628-25-7, is also known as 2-Methyl-4-decanone. This chemical's molecular formula is C₁₁H₂₂O and molecular weight is 170.29. What's more, its systematic name is 2-methyldecan-4-one. 

Physical properties of 4-Decanone,2-methyl- are: (1)ACD/LogP: 3.91; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.91; (4)ACD/LogD (pH 7.4): 3.91; (5)ACD/BCF (pH 5.5): 551.11; (6)ACD/BCF (pH 7.4): 551.11; (7)ACD/KOC (pH 5.5): 3189.95; (8)ACD/KOC (pH 7.4): 3189.95; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 7; (12)Polar Surface Area: 17.07 Å²; (13)Index of Refraction: 1.424; (14)Molar Refractivity: 52.99 cm³; (15)Molar Volume: 207.6 cm³; (16)Polarizability: 21.01×10^-24 cm³; (17)Surface Tension: 26.7 dyne/cm; (18)Density: 0.82 g/cm³; (19)Flash Point: 81.8 °C; (20)Enthalpy of Vaporization: 45.41 kJ/mol; (21)Boiling Point: 217.7 °C at 760 mmHg; (22)Vapour Pressure: 0.131 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: O=C(CCCCCC)CC(C)C
(2)InChI: InChI=1/C11H22O/c1-4-5-6-7-8-11(12)9-10(2)3/h10H,4-9H2,1-3H3
(3)InChIKey: QNIWMSRDAQBYHO-UHFFFAOYAM