The 4-Dibenzofuranamine, with the CAS registry number 50548-43-1, is also known as 4-Aminodibenzofuran. This chemical's molecular formula is C₁₂H₉NO and molecular weight is 183.20596. Its systematic name is called dibenzo[b,d]furan-4-amine.

Physical properties of 4-Dibenzofuranamine: (1)ACD/LogP: 2.84; (2)ACD/LogD (pH 5.5): 2.84; (3)ACD/LogD (pH 7.4): 2.84; (4)ACD/BCF (pH 5.5): 84.05; (5)ACD/BCF (pH 7.4): 84.49; (6)ACD/KOC (pH 5.5): 828.93; (7)ACD/KOC (pH 7.4): 833.35; (8)#H bond acceptors: 2; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.755; (12)Molar Refractivity: 58.47 cm³; (13)Molar Volume: 142.7 cm³; (14)Surface Tension: 58.4 dyne/cm; (15)Density: 1.283 g/cm³; (16)Flash Point: 177 °C; (17)Enthalpy of Vaporization: 61.58 kJ/mol; (18)Boiling Point: 369.1 °C at 760 mmHg; (19)Vapour Pressure: 1.21E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: o1c3c(c2cccc(c12)N)cccc3
(2)InChI: InChI=1/C12H9NO/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7H,13H2
(3)InChIKey: QKBTTXJHJNXCOQ-UHFFFAOYAM