Products Categories
| CAS No.: | 10501-17-4 |
|---|---|
| Name: | 5-Ethoxyindole |
| Molecular Structure: | |
|
|
|
| Formula: | C10H11NO |
| Molecular Weight: | 161.203 |
| Synonyms: | 5-Ethyloxyindole;1-Ethoxyindole; |
| Density: | 1.132 g/cm3 |
| Melting Point: | 35-36 °C |
| Boiling Point: | 309 °C at 760 mmHg |
| Flash Point: | 113.3 °C |
| Hazard Symbols: |
Xi
|
| Risk Codes: | Xi:; "> |
| PSA: | 25.02000 |
| LogP: | 2.56660 |
The CAS registry number of 5-Ethoxyindole is 10501-17-4. The IUPAC name is 5-ethoxy-1H-indole. In addition, the molecular formula is C10H11NO and the molecular weight is 161.20. It is also called 1-ethoxyindole. What's more, it should be stored in sealed container, and put them in a cool and dry place.
Physical properties about 5-Ethoxyindole are: (1)ACD/LogP: 2.59; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.59; (4)ACD/LogD (pH 7.4): 2.59; (5)ACD/BCF (pH 5.5): 54.67; (6)ACD/BCF (pH 7.4): 54.67; (7)ACD/KOC (pH 5.5): 610.24; (8)ACD/KOC (pH 7.4): 610.24; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 14.16 Å2; (13)Index of Refraction: 1.617; (14)Molar Refractivity: 49.83 cm3; (15)Molar Volume: 142.3 cm3; (16)Polarizability: 19.75 ×10-24cm3; (17)Surface Tension: 44.2 dyne/cm; (18)Density: 1.132 g/cm3; (19)Flash Point: 113.3 °C; (20)Enthalpy of Vaporization: 52.78 kJ/mol; (21)Boiling Point: 309 °C at 760 mmHg; (22)Vapour Pressure: 0.0012 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: O(c1cc2c(cc1)ncc2)CC
(2)InChI: InChI=1/C10H11NO/c1-2-12-9-3-4-10-8(7-9)5-6-11-10/h3-7,11H,2H2,1H3
(3)InChIKey: IEKPDICCMASELW-UHFFFAOYAS