The 3H-Indazol-3-one,1,2-dihydro-5-methoxy-, with the CAS registry number 99719-37-6, is also known as 5-Methoxy-1H-indazol-3-ol. This chemical's molecular formula is C₈H₈N₂O₂ and molecular weight is 164.16. Its IUPAC name is called 5-methoxy-1,2-dihydroindazol-3-one.

Physical properties of 3H-Indazol-3-one,1,2-dihydro-5-methoxy-: (1)ACD/LogP: 1.51; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/LogD (pH 7.4): 1; (5)ACD/BCF (pH 5.5): 3; (6)ACD/BCF (pH 7.4): 3; (7)ACD/KOC (pH 5.5): 84; (8)ACD/KOC (pH 7.4): 84; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Index of Refraction: 1.565; (13)Molar Refractivity: 42.709 cm³; (14)Molar Volume: 131.091 cm³; (15)Surface Tension: 41.477 dyne/cm; (16)Density: 1.252 g/cm³; (17)Flash Point: 110.564 °C; (18)Enthalpy of Vaporization: 49.684 kJ/mol; (19)Boiling Point: 259.205 °C at 760 mmHg; (20)Vapour Pressure: 0.013 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: COC1=CC2=C(C=C1)NNC2=O
(2)InChI: InChI=1S/C8H8N2O2/c1-12-5-2-3-7-6(4-5)8(11)10-9-7/h2-4H,1H3,(H2,9,10,11)
(3)InChIKey: JVIODNHCPBUTPK-UHFFFAOYSA-N