Products Categories
| CAS No.: | 46053-72-9 |
|---|---|
| Name: | 5-nitroisoindoline |
| Molecular Structure: | |
|
|
|
| Formula: | C8H8N2O2 |
| Molecular Weight: | 164.164 |
| Synonyms: | 5-nitro-2,3-dihydro-1H-isoindole; |
| Density: | 1.298 g/cm3 |
| Boiling Point: | 292.5 °C at 760 mmHg |
| Flash Point: | 130.7 °C |
| PSA: | 57.85000 |
| LogP: | 2.05000 |
The 5-nitroisoindoline has the CAS registry number 46053-72-9. This chemical's molecular formula is C8H8N2O2 and molecular weight is 164.16. Its systematic name is called 5-nitro-2,3-dihydro-1H-isoindole.
Physical properties of 5-nitroisoindoline: (1)ACD/LogP: 0.74; (2)#H bond acceptors: 4; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 1; (5)Index of Refraction: 1.608; (6)Molar Refractivity: 43.7 cm3; (7)Molar Volume: 126.3 cm3; (8)Surface Tension: 53.4 dyne/cm; (9)Density: 1.298 g/cm3; (10)Flash Point: 130.7 °C; (11)Enthalpy of Vaporization: 53.2 kJ/mol; (12)Boiling Point: 292.5 °C at 760 mmHg; (13)Vapour Pressure: 0.00183 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: [O-][N+](=O)c1ccc2c(c1)CNC2
(2)InChI: InChI=1/C8H8N2O2/c11-10(12)8-2-1-6-4-9-5-7(6)3-8/h1-3,9H,4-5H2
(3)InChIKey: UYSFPRNOPWMPJW-UHFFFAOYAQ