This chemical has the IUPAC name 6-bromo-1-benzothiophene. With the CAS registry number 17347-32-9, it is also called Benzo[b]thiophene,6-bromo-. Its molecular formula is C₈H₅BrS and its molecular weight is 213.09.

The properties of the 6-Bromobenzo[b]thiophene are: (1)ACD/LogP: 3.89; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4; (4)ACD/LogD (pH 7.4): 4; (5)ACD/BCF (pH 5.5): 528; (6)ACD/BCF (pH 7.4): 528; (7)ACD/KOC (pH 5.5): 3094; (8)ACD/KOC (pH 7.4): 3094; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 28.24 Å²; (13)Index of Refraction: 1.704; (14)Molar Refractivity: 50.17 cm³; (15)Molar Volume: 129.214 cm³; (16)Polarizability: 19.889×10^-24cm³; (17)Surface Tension: 50.681 dyne/cm; (18)Enthalpy of Vaporization: 50.269 kJ/mol; (19)Vapour Pressure: 0.005 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: c1cc(cc2c1ccs2)Br
(2)InChI: InChI=1/C8H5BrS/c9-7-2-1-6-3-4-10-8(6)5-7/h1-5H
(3)InChIKey: OQIMJOXSDVGEBU-UHFFFAOYAM