The 6-Pteridineacetic acid, 2-amino-1,4,7,8-tetrahydro-4,7-dioxo-, ethyl ester has the CAS registry number 33350-18-4. This chemical's molecular formula is C₁₀H₁₁N₅O₄ and molecular weight is 265.23. What's more, its systematic name is ethyl (2-amino-4,7-dioxo-1,4,7,8-tetrahydropteridin-6-yl)acetate.

Physical properties of 6-Pteridineacetic acid, 2-amino-1,4,7,8-tetrahydro-4,7-dioxo-, ethyl ester are: (1)ACD/LogP: -2.24; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 9; (4)#H bond donors: 4; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 94.88 Å²; (7)Index of Refraction: 1.756; (8)Molar Refractivity: 61.42 cm³; (9)Molar Volume: 149.7 cm³; (10)Polarizability: 24.34×10^-24cm³; (11)Surface Tension: 78.5 dyne/cm; (12)Density: 1.77 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C\1NC=2N/C(=N\C(=O)C=2/N=C/1CC(=O)OCC)N
(2)InChI: InChI=1S/C10H11N5O4/c1-2-19-5(16)3-4-8(17)13-7-6(12-4)9(18)15-10(11)14-7/h2-3H2,1H3,(H4,11,13,14,15,17,18)
(3)InChIKey: WIRZDQXKDYQIEU-UHFFFAOYSA-N