The Acetic acid,2,2,2-trifluoro-, lead(2+) salt (2:1) with CAS registry number of 4146-73-0 is also known as Lead II trifluoroacetate, hemihydrate. The systematic name is Bis[(2,2,2-trifluoroacetyl)oxy]lead. In addition, the formula is C₂HF₃O₂.1/2Pb and the molecular weight is 216.62. This chemical is stable at normal temperature and pressure, and it should be stored in sealed containers in cool, dry place.

Physical properties about Acetic acid,2,2,2-trifluoro-, lead(2+) salt (2:1) are: (1)#H bond acceptors: 4; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 4; (4)Polar Surface Area: 52.6Ų.

When you are using this chemical, please be cautious about it. As a chemical, it's harmful by inhalation, in contact with skin and if swallowed. What's more, it has danger of cumulative effects. During using it, wear suitable protective clothing.

You can still convert the following datas into molecular structure: 
1. SMILES: C(=O)(C(F)(F)F)O[Pb]OC(=O)C(F)(F)F
2. InChI: InChI=1/2C2HF3O2.Pb/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/q;;+2/p-2
3. InChIKey: XVULNTYAIWEMSW-NUQVWONBAK
4. Std. InChI: InChI=1S/2C2HF3O2.Pb/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/q;;+2/p-2
5. Std. InChIKey: XVULNTYAIWEMSW-UHFFFAOYSA-L