Acid Red 42 with molecular formula of C₂₂H₁₆N₃NaO₆S₂ is a kind of dyes. Its cas registry number is 6245-60-9. Besides this, it also has other registry number which is 39280-62-1. Its EINECS registry number is 228-359-0. Its systematic name is called sodium 6-amino-5-[2-(benzenesulfonyl)phenyl]azo-4-hydroxy-naphthalene-2-sulfonate. And its IUPAC name is called sodium 5-[2-[2-(benzenesulfonyl)phenyl]hydrazinyl]-6-imino-4-oxonaphthalene-2-sulfonate. This chemical is also known as 2-Naphthalenesulfonic acid, 6-amino-4-hydroxy-5-((2-(phenylsulfonyl)phenyl)azo)-, monosodium salt.

Physical properties about this chemical are: (1)#H bond acceptors: 9; (2)#H bond donors: 4; (3)#Freely Rotating Bonds: 7; (4)Polar Surface Area: 179.07 Å².

You can still convert the following datas into molecular structure:
(1)InChI: InChI=1/C22H17N3O6S2.Na/c23-17-11-10-14-12-16(33(29,30)31)13-19(26)21(14)22(17)25-24-18-8-4-5-9-20(18)32(27,28)15-6-2-1-3-7-15;/h1-13,26H,23H2,(H,29,30,31);/q;+1/p-1/b25-24+;
(2)Smiles: [Na+].c1c(cc(c2c(c(ccc12)N)\N=N\c1c(cccc1)S(=O)(=O)c1ccccc1)O)S(=O)(=O)[O-]