The Anilinephthalein, with the CAS registry number 509-77-3, is also known as 1(3H)-Isobenzofuranone, 3,3-bis(4-aminophenyl)-. Its EINECS registry number is 208-105-5. This chemical's molecular formula is C₂₀H₁₆N₂O₂ and molecular weight is 316.3532. Its systematic name is called 3,3-bis(4-aminophenyl)-2-benzofuran-1(3H)-one.

Physical properties of Anilinephthalein: (1)ACD/LogP: 1.54; (2)ACD/LogD (pH 5.5): 1.5; (3)ACD/LogD (pH 7.4): 1.54; (4)ACD/BCF (pH 5.5): 7.99; (5)ACD/BCF (pH 7.4): 8.69; (6)ACD/KOC (pH 5.5): 150.38; (7)ACD/KOC (pH 7.4): 163.59; (8)#H bond acceptors: 4; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 4; (11)Index of Refraction: 1.71; (12)Molar Refractivity: 92.81 cm³; (13)Molar Volume: 237.4 cm³; (14)Surface Tension: 66.4 dyne/cm; (15)Density: 1.332 g/cm³; (16)Flash Point: 271 °C; (17)Enthalpy of Vaporization: 84.88 kJ/mol; (18)Boiling Point: 565.1 °C at 760 mmHg; (19)Vapour Pressure: 8.63E-13 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C1OC(c2ccccc12)(c3ccc(N)cc3)c4ccc(N)cc4
(2)InChI: InChI=1/C20H16N2O2/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20/h1-12H,21-22H2
(3)InChIKey: PLYHMRQAXIKUIV-UHFFFAOYAP