The Azulene, 4-methyl-, with the CAS registry number 17647-77-7, is also known as AC1L3GKS. This chemical's molecular formula is C₁₁H₁₀ and molecular weight is 142.1971. Its IUPAC name is called 4-methylazulene.

Physical properties of Azulene, 4-methyl-: (1)ACD/LogP: 3.91; (2)ACD/LogD (pH 5.5): 3.91; (3)ACD/LogD (pH 7.4): 3.91; (4)ACD/BCF (pH 5.5): 550.66; (5)ACD/BCF (pH 7.4): 550.66; (6)ACD/KOC (pH 5.5): 3188.07; (7)ACD/KOC (pH 7.4): 3188.07; (8)Index of Refraction: 1.616; (9)Molar Refractivity: 48.92 cm³; (10)Molar Volume: 139.8 cm³; (11)Surface Tension: 38.7 dyne/cm; (12)Density: 1.016 g/cm³; (13)Flash Point: 93.6 °C; (14)Enthalpy of Vaporization: 46.02 kJ/mol; (15)Boiling Point: 242.6 °C at 760 mmHg; (16)Vapour Pressure: 0.0523 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1=CC=CC=C2C1=CC=C2
(2)InChI: InChI=1S/C11H10/c1-9-5-2-3-6-10-7-4-8-11(9)10/h2-8H,1H3
(3)InChIKey: RVJUDUADOMIBMH-UHFFFAOYSA-N