The CAS register number of Azur B is 8006-34-6. It also can be called as Methylene Azure B and the systematic name about this chemical is 3-(dimethylamino)-7-(methylamino)phenothiazin-5-ium chloride. The molecular formula about this chemical is C₁₅H₁₆ClN₃S and molecular weight is 305.83. When you are using it, please do not breathe vapour. In the using process, please avoid contact with skin and eyes.

Physical properties about Azur B are: (1)#H bond acceptors: 3; (2)#H bond donors: 1; (3)#Freely Rotating Bonds: 2; (4)Polar Surface Area: 28.16Ų.

You can still convert the following datas into molecular structure:
(1)SMILES: [Cl-].CN(C)c1cc2[s+]c3cc(NC)ccc3nc2cc1
(2)InChI: InChI=1/C15H16N3S.ClH/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;/h4-9,16H,1-3H3;1H/q+1;/p-1
(3)InChIKey: KFZNPGQYVZZSNV-REWHXWOFAE
(4)Std. InChI: InChI=1S/C15H16N3S.ClH/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;/h4-9,16H,1-3H3;1H/q+1;/p-1
(5)Std. InChIKey: KFZNPGQYVZZSNV-UHFFFAOYSA-M