The Benzaldehyde,4-(methylthio)-, oxime, with the CAS registry number 93033-60-4, is also known as ZINC03337437. This chemical's molecular formula is C₈H₉NOS and molecular weight is 167.22816. Its IUPAC name is called (NE)-N-[(4-methylsulfanylphenyl)methylidene]hydroxylamine.

Physical properties of Benzaldehyde,4-(methylthio)-, oxime: (1)ACD/LogP: 2.76; (2)ACD/LogD (pH 5.5): 2.76; (3)ACD/LogD (pH 7.4): 2.76; (4)ACD/BCF (pH 5.5): 73.21; (5)ACD/BCF (pH 7.4): 73.2; (6)ACD/KOC (pH 5.5): 752.08; (7)ACD/KOC (pH 7.4): 751.99; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.566; (12)Molar Refractivity: 48.39 cm³; (13)Molar Volume: 148.3 cm³; (14)Surface Tension: 41.2 dyne/cm; (15)Density: 1.12 g/cm³; (16)Flash Point: 120.8 °C; (17)Enthalpy of Vaporization: 54.36 kJ/mol; (18)Boiling Point: 276.1 °C at 760 mmHg; (19)Vapour Pressure: 0.00236 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CSC1=CC=C(C=C1)C=NO
(2)Isomeric SMILES: CSC1=CC=C(C=C1)/C=N/O
(3)InChI: InChI=1S/C8H9NOS/c1-11-8-4-2-7(3-5-8)6-9-10/h2-6,10H,1H3/b9-6+
(4)InChIKey: TVMICSMBUZCYHJ-RMKNXTFCSA-N