The CAS registry number Benzamide,2-chloro-N-(4-hydroxyphenyl)- is 35607-02-4. This chemical's molecular formula is C₁₃H₁₀ClNO₂and molecular weight is 247.677. What's more, both its IUPAC name and systematic name are the same which is called 2-Chloro-N-(4-hydroxyphenyl)benzamide.

Physical properties about Benzamide,2-chloro-N-(4-hydroxyphenyl)- are: (1)ACD/LogP: 2.05; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.05; (4)ACD/LogD (pH 7.4): 2.05; (5)ACD/BCF (pH 5.5): 21.23; (6)ACD/BCF (pH 7.4): 21.2; (7)ACD/KOC (pH 5.5): 310.1; (8)ACD/KOC (pH 7.4): 309.58; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 29.54 Å²; (13)Index of Refraction: 1.681; (14)Molar Refractivity: 67.6 cm³; (15)Molar Volume: 178.6 cm³; (16)Polarizability: 26.8×10^-24 cm³; (17)Surface Tension: 60.2 dyne/cm; (18)Density: 1.386 g/cm³; (19)Flash Point: 160.9 °C; (20)Enthalpy of Vaporization: 60.94 kJ/mol; (21)Boiling Point: 342.4 °C at 760 mmHg; (22)Vapour Pressure: 3.81E-05 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(c1ccccc1Cl)Nc2ccc(O)cc2
(2)InChI: InChI=1/C13H10ClNO2/c14-12-4-2-1-3-11(12)13(17)15-9-5-7-10(16)8-6-9/h1-8,16H,(H,15,17)
(3)InChIKey: OLWMCHGHFRPBTM-UHFFFAOYAH