The CAS registry number of Benzamide, N-[(dibutylamino)thioxomethyl]- is 68141-55-9. This chemical's molecular formula is C₁₆H₂₄N₂OS and molecular weight is 292.44. What's more, its systematic name is N-(Dibutylcarbamothioyl)benzamide. 

Physical properties about Benzamide, N-[(dibutylamino)thioxomethyl]- are: (1)ACD/LogP: 4.21; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.21; (4)ACD/LogD (pH 7.4): 4.21; (5)ACD/BCF (pH 5.5): 938.61; (6)ACD/BCF (pH 7.4): 937.21; (7)ACD/KOC (pH 5.5): 4669.86; (8)ACD/KOC (pH 7.4): 4662.89; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 7; (12)Polar Surface Area: 55.64 Ų; (13)Index of Refraction: 1.554; (14)Molar Refractivity: 87.94 cm³; (15)Molar Volume: 274 cm³; (16)Polarizability: 34.86×10^-24 cm³; (17)Surface Tension: 45.2 dyne/cm; (18) Density: 1.067 g/cm³.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(NC(=S)N(CCCC)CCCC)c1ccccc1
(2)InChI:InChI=1/C16H24N2OS/c1-3-5-12-18(13-6-4-2)16(20)17-15(19)14-10-8-7-9-11-14/h7-11H,3-6,12-13H2,1-2H3,(H,17,19,20)
(3)InChIKey: CRZCQVXNPTXOMF-UHFFFAOYAI