The Benzenamine,N-(3,4-difluorophenyl)-3,4-difluoro- has the CAS registry number 330-48-3. This chemical's molecular formula is C₁₂H₇F₄N and molecular weight is 241.18. What's more, its systematic name is N-(3,4-difluorophenyl)-3,4-difluoroaniline.

Physical properties of Benzenamine,N-(3,4-difluorophenyl)-3,4-difluoro- are: (1)ACD/LogP: 4.66; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 1; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 3.24 Å²; (7)Index of Refraction: 1.558; (8)Molar Refractivity: 55.6 cm³; (9)Molar Volume: 172.3 cm³; (10)Polarizability: 22.04×10^-24cm³; (11)Surface Tension: 38.4 dyne/cm; (12)Density: 1.399 g/cm³; (13)Flash Point: 115.4 °C; (14)Enthalpy of Vaporization: 50.53 kJ/mol; (15)Boiling Point: 267.3 °C at 760 mmHg; (16)Vapour Pressure: 0.00824 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=C(C=C1NC2=CC(=C(C=C2)F)F)F)F
(2)InChI: InChI=1S/C12H7F4N/c13-9-3-1-7(5-11(9)15)17-8-2-4-10(14)12(16)6-8/h1-6,17H
(3)InChIKey: ZRJAVMVAQXIURD-UHFFFAOYSA-N