The CAS registry number of Benzenesulfonamide,3-amino-N,N,4-trimethyl- is 6331-68-6. This chemical is also named as p-Toluenesulfonamide,3-amino-N,N-dimethyl- (6CI,8CI). The EINECS registry number of it is 228-707-1. In addition, its molecular formula is C₉H₁₄N₂O₂S and molecular weight is 214.28466. Its systematic name is called 3-amino-N,N,4-trimethylbenzenesulfonamide.

Physical properties about Benzenesulfonamide,3-amino-N,N,4-trimethyl- are: (1)ACD/LogP: 0.28; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 3; (6)Index of Refraction: 1.57; (7)Molar Refractivity: 56.94 cm³; (8)Molar Volume: 173.5 cm³; (9)Surface Tension: 47.6 dyne/cm; (10)Density: 1.234 g/cm³; (11)Flash Point: 178.2 °C; (12)Enthalpy of Vaporization: 61.81 kJ/mol; (13)Boiling Point: 371.1 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: O=S(=O)(c1cc(N)c(cc1)C)N(C)C
(2)InChI: InChI=1/C9H14N2O2S/c1-7-4-5-8(6-9(7)10)14(12,13)11(2)3/h4-6H,10H2,1-3H3
(3)InChIKey: PNFOLOVDVLPCBX-UHFFFAOYAI