This chemical's CAS registry number is 69164-27-8 and it also known as Benzo[h]-1,6-naphthyridine-5-carboxaldehyde. This chemical's molecular formula is C₁₃H₈N₂O and molecular weight is 208.22. What's more, both the product name and systematic name are the same which is called Benzo[h][1,6]naphthyridine-5-carbaldehyde.

Physical properties about Benzo[h][1,6]naphthyridine-5-carbaldehyde are: (1)ACD/LogP: 1.86; (2)#of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 42.85 Å²; (7)Index of Refraction: 1.772; (8)Molar Refractivity: 64.87 cm³; (9)Molar Volume: 155.7 cm³; (10)Polarizability: 25.71×10^-24 cm³; (11)Surface Tension: 68.5 dyne/cm; (12)Density: 1.336 g/cm³; (13)Flash Point: 218.2 °C; (14)Enthalpy of Vaporization: 69.25 kJ/mol; (15)Boiling Point: 436.1 °C at 760 mmHg; (16)Vapour Pressure: 8.28E-08 mmHg at 25 °C; (17)Melting Point: 144 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: O=Cc2nc3c(c1ncccc12)cccc3
(2) InChI: InChI=1/C13H8N2O/c16-8-12-10-5-3-7-14-13(10)9-4-1-2-6-11(9)15-12/h1-8H
(3) InChIKey: PNCCXVYVMZWAQH-UHFFFAOYAW