The Benzoic acid,5-amino-2,3,4-trifluoro- has the CAS registry number 203916-57-8. This chemical's molecular formula is C₇H₄F₃NO₂ and molecular weight is 191.11. What's more, its systematic name is 5-Amino-2,3,4-trifluorobenzoic acid and it belongs to the product categories of Amino acid. 

Physical properties of Benzoic acid,5-amino-2,3,4-trifluoro- are: (1)ACD/LogP: 2.03; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 3; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 63.32 Å²; (11)Index of Refraction: 1.553; (12)Molar Refractivity: 37.4 cm³; (13)Molar Volume: 116.872 cm³; (14)Polarizability: 14.827×10^-24 cm³; (15)Surface Tension: 53.857 dyne/cm; (16)Density: 1.635 g/cm³; (17)Flash Point: 155.523 °C; (18)Enthalpy of Vaporization: 60.842 kJ/mol; (19)Boiling Point: 333.546 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: Fc1c(F)c(cc(N)c1F)C(=O)O
(2)InChI: InChI=1/C7H4F3NO2/c8-4-2(7(12)13)1-3(11)5(9)6(4)10/h1H,11H2,(H,12,13)
(3)InChIKey: LXBTXBZKLHORRQ-UHFFFAOYSA-N