The Benzoicacid, 2-[bis(3-methoxyphenyl)methyl]- has the CAS registry number 6315-41-9. This chemical's molecular formula is C₂₂H₂₀O₄ and molecular weight is 348.39. What's more, its systematic name is 2-[Bis(3-methoxyphenyl)methyl]benzoic acid.

Physical properties of Benzoicacid, 2-[bis(3-methoxyphenyl)methyl]- are: (1)ACD/LogP: 5.20; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 4; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 6; (6)Polar Surface Area: 44.76 Å²; (7)Index of Refraction: 1.599; (8)Molar Refractivity: 100.25 cm³; (9)Molar Volume: 293.2 cm³; (10)Polarizability: 39.74×10^-24 cm³; (11)Surface Tension: 46.7 dyne/cm; (12)Density: 1.188 g/cm³; (13)Flash Point: 178.9 °C; (14)Enthalpy of Vaporization: 82.52 kJ/mol; (15)Boiling Point: 512.5 °C at 760 mmHg; (16)Vapour Pressure: 2.5E-11 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)c1ccccc1C(c2cc(OC)ccc2)c3cccc(OC)c3
(2)InChI: InChI=1/C22H20O4/c1-25-17-9-5-7-15(13-17)21(16-8-6-10-18(14-16)26-2)19-11-3-4-12-20(19)22(23)24/h3-14,21H,1-2H3,(H,23,24)
(3)InChIKey: FSLFYNWIPDXIFO-UHFFFAOYSA-N