The Bis(1-hydroxy-1H-pyridine-2-thionato-O,S)copper, with the CAS registry number 14915-37-8, is also known as Copper(2+) bis(2-thioxo-1(2H)-pyridinolate). Its EINECS registry number is 238-984-0. This chemical's molecular formula is C₁₀H₈CuN₂O₂S₂ and molecular weight is 315.86. What's more, its IUPAC name is called Copper 1-oxidopyridine-2-thione.

Physical properties about Bis(1-hydroxy-1H-pyridine-2-thionato-O,S)copper are: (1)ACD/LogP: -0.051; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.91; (4)ACD/LogD (pH 7.4): -2.74; (5)ACD/BCF (pH 5.5): 1.00; (6)ACD/BCF (pH 7.4): 1.00; (7)ACD/KOC (pH 5.5): 3.06; (8)ACD/KOC (pH 7.4): 1.00; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 55.56 Å²; (13)Flash Point: 107.3 °C; (14)Enthalpy of Vaporization: 57.06 kJ/mol; (15)Boiling Point: 253.8 °C at 760 mmHg; (16)Vapour Pressure: 0.00275 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: [Cu+2].S=C1/C=C\C=C/N1[O-].S=C\1N([O-])\C=C/C=C/1
(2) InChI: InChI=1S/2C5H4NOS.Cu/c2*7-6-4-2-1-3-5(6)8;/h2*1-4H;/q2*-1;+2
(3) InChIKey: XDUPUJNNHFTMQS-UHFFFAOYSA-N

The toxicity data is as follows: