10310-02-8 Usage
Uses
Given the general applications of nitro and methoxy compounds, 5-Methoxy-6-nitro-1,3-benzodioxole could potentially be used in the following areas:
Used in Pharmaceutical Industry:
5-Methoxy-6-nitro-1,3-benzodioxole may be utilized as an intermediate or active ingredient in the development of pharmaceuticals, given the common use of nitro and methoxy compounds in drug synthesis. Its specific role would depend on further research into its pharmacological properties and potential therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Methoxy-6-nitro-1,3-benzodioxole could serve as a precursor or component in the formulation of pesticides or other agricultural chemicals, leveraging the properties of nitro and methoxy compounds to enhance the effectiveness of these products.
Used in Dye and Pigment Industry:
5-Methoxy-6-nitro-1,3-benzodioxole may also find application in the production of dyes and pigments, where nitro compounds are known for their color-producing capabilities. Its specific use would be determined by its color and stability characteristics in various media.
Used in Fragrance Industry:
5-Methoxy-6-nitro-1,3-benzodioxole could be employed in the creation of fragrance ingredients, as methoxy compounds are often used to impart specific scents or modify the olfactory profile of fragrances.
Check Digit Verification of cas no
The CAS Registry Mumber 10310-02-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,1 and 0 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 10310-02:
(7*1)+(6*0)+(5*3)+(4*1)+(3*0)+(2*0)+(1*2)=28
28 % 10 = 8
So 10310-02-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H7NO5/c1-12-6-3-8-7(13-4-14-8)2-5(6)9(10)11/h2-3H,4H2,1H3
