118399-01-2 Usage
Physical state
Yellow liquid At room temperature, 1-Methyl-3-isopropyltriazene exists as a yellow liquid.
Common uses
Synthesis of organic compounds This compound is frequently used as a building block in the creation of other organic compounds.
Industrial applications
Production of pharmaceuticals, agrochemicals, and fine chemicals 1-Methyl-3-isopropyltriazene serves as a precursor in the manufacturing process of various pharmaceuticals, agrochemicals, and other specialty chemicals.
Biological activity
Potent inhibitor of ribonucleotide reductase This compound is known to effectively inhibit the enzyme ribonucleotide reductase, which plays a crucial role in DNA synthesis and repair.
Potential therapeutic use
Cancer therapy Due to its ability to inhibit ribonucleotide reductase, 1-Methyl-3-isopropyltriazene may have potential applications in the development of cancer treatments.
Relevance
Importance in organic chemistry and pharmaceutical research 1-Methyl-3-isopropyltriazene holds significant value in the fields of organic chemistry and pharmaceutical research due to its unique properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 118399-01-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,3,9 and 9 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 118399-01:
(8*1)+(7*1)+(6*8)+(5*3)+(4*9)+(3*9)+(2*0)+(1*1)=142
142 % 10 = 2
So 118399-01-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H11N3/c1-4(2)6-7-5-3/h4H,1-3H3,(H,5,6)
