138226-16-1 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-Chloro-5-(hydroxy(oxido)amino)phenyl)-3H-[1,3]thiazolo[3,4-a]benz imidazole is used as a potential pharmaceutical agent for its unique structure and bioactive properties. The presence of multiple functional groups allows for various interactions with biological targets, which could be exploited for the development of new drugs.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 1-(2-Chloro-5-(hydroxy(oxido)amino)phenyl)-3H-[1,3]thiazolo[3,4-a]benz imidazole serves as a molecule of interest for further research and development. Its complex structure and potential bioactivity make it a valuable compound for exploring new therapeutic approaches and understanding the underlying mechanisms of action.
Used in Drug Design and Development:
1-(2-Chloro-5-(hydroxy(oxido)amino)phenyl)-3H-[1,3]thiazolo[3,4-a]benz imidazole is used as a starting point for drug design and development. Its unique structure and functional groups can be modified and optimized to create new molecules with improved pharmacological properties, potentially leading to the discovery of novel therapeutic agents.
Used in Chemical Synthesis:
1-(2-Chloro-5-(hydroxy(oxido)amino)phenyl)-3H-[1,3]thiazolo[3,4-a]benz imidazole can also be used as a building block or intermediate in the synthesis of other complex molecules. Its unique structure and functional groups make it a valuable component for creating new chemical entities with diverse applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 138226-16-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,2,2 and 6 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 138226-16:
(8*1)+(7*3)+(6*8)+(5*2)+(4*2)+(3*6)+(2*1)+(1*6)=121
121 % 10 = 1
So 138226-16-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H10ClN3O2S/c16-11-6-5-9(19(20)21)7-10(11)15-18-13-4-2-1-3-12(13)17-14(18)8-22-15/h1-7,15H,8H2
138226-16-1Relevant articles and documents
One-pot synthesis of 1-aryl-1 H,3 H-thiazolo[3,4-a[benzimidazoles using magnetite-linked sulfonic acid as catalyst
Wu, Liqiang,Wang, Xiao
, p. 1851 - 1857 (2015/10/29)
A series of 1-aryl-1H,3H-thiazolo[3,4-a]benzimidazole derivatives have been synthesized via the three-component reaction of o-phenylenediamine, aromatic aldehydes, and 2-mercaptoacetic acid, catalyzed by magnetite-linked sulfonic acid. This method has the