142074-49-5 Usage
Uses
Used in Organic Chemistry:
2-(Ethoxycarbonyl)isonicotinic acid is used as a chemical intermediate for the synthesis of more complex chemical compounds. Its role in this application is to facilitate the creation of new molecules that can be used in various industries and applications.
Used in Research and Development:
In the field of research and development, 2-(Ethoxycarbonyl)isonicotinic acid is used as a starting material for the exploration of new chemical reactions and the development of novel compounds. This can lead to the discovery of new substances with potential applications in various sectors, such as pharmaceuticals, materials science, or agriculture.
Used in Pharmaceutical Industry:
Although there is limited information available, 2-(Ethoxycarbonyl)isonicotinic acid may be used as a building block in the synthesis of pharmaceutical compounds. Its potential applications in this industry could include the development of new drugs or the improvement of existing ones, depending on its chemical properties and reactivity.
Used in Material Science:
In material science, 2-(Ethoxycarbonyl)isonicotinic acid could be used as a component in the development of new materials with specific properties, such as improved strength, flexibility, or resistance to certain conditions. Its role in this application would be to contribute to the overall structure and characteristics of the final material.
Check Digit Verification of cas no
The CAS Registry Mumber 142074-49-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,0,7 and 4 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 142074-49:
(8*1)+(7*4)+(6*2)+(5*0)+(4*7)+(3*4)+(2*4)+(1*9)=105
105 % 10 = 5
So 142074-49-5 is a valid CAS Registry Number.
InChI:InChI=1S/C9H9NO4/c1-2-14-9(13)7-5-6(8(11)12)3-4-10-7/h3-5H,2H2,1H3,(H,11,12)
