198959-37-4 Usage
Uses
METHYL 3-PYRROLIDINECARBOXYLATE HCL is used in various research and development applications for its unique chemical properties and reactivity. The specific uses may vary depending on the industry and the requirements of the project. However, the general applications can be categorized as follows:
Used in Pharmaceutical Research:
METHYL 3-PYRROLIDINECARBOXYLATE HCL is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Synthesis:
In the field of organic chemistry, METHYL 3-PYRROLIDINECARBOXYLATE HCL is used as a building block for the synthesis of more complex molecules. Its versatility in forming different types of chemical bonds makes it a valuable asset in creating novel compounds with potential applications in various industries.
Used in Material Science:
METHYL 3-PYRROLIDINECARBOXYLATE HCL is used as a component in the development of new materials with specific properties, such as improved stability, reactivity, or biocompatibility. Its incorporation into these materials can lead to advancements in areas like electronics, coatings, and medical devices.
Used in Analytical Chemistry:
METHYL 3-PYRROLIDINECARBOXYLATE HCL is used as a reference compound or a standard in analytical chemistry for the calibration of instruments and the development of new analytical methods. Its well-defined chemical properties make it suitable for these applications, ensuring accurate and reliable results in various analyses.
Check Digit Verification of cas no
The CAS Registry Mumber 198959-37-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,8,9,5 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 198959-37:
(8*1)+(7*9)+(6*8)+(5*9)+(4*5)+(3*9)+(2*3)+(1*7)=224
224 % 10 = 4
So 198959-37-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO2.ClH/c1-9-6(8)5-2-3-7-4-5;/h5,7H,2-4H2,1H3;1H
198959-37-4Relevant academic research and scientific papers
SUBSTITUTED 1,1'-BIPHENYL COMPOUNDS AND METHODS USING SAME
-
Page/Page column 648-649, (2021/08/13)
The present invention includes substituted 1,1'-biphenyl compounds, analogues thereof, and compositions comprising the same. In one aspect, the compounds contemplated in the invention can be used to treat, ameliorate, or prevent hepatitis B virus (HBV) and/or hepatitis D virus (HDV) infections in a patient. In another aspect, the compounds contemplated in the invention can be used to treat, ameliorate, and/or prevent cancer in a patient.
PYRAZOLO-TRIAZINE AND/OR PYRAZOLO-PYRIMIDINE DERIVATIVES AS SELECTIVE INHIBITOR OF CYCLIN DEPENDENT KINASE
-
Page/Page column 50; 89, (2019/11/04)
The present invention relates to pyrazolo[1,5-a][1,3,5]triazine and pyrazolo[l,5-a]pyrimidine derivatives and/or pharmaceutically acceptable salts thereof, the use of these derivatives as pharmaceutically active agents, especially for the prophylaxis and/or treatment of cell proliferative diseases, inflammatory diseases, immunological diseases, cardiovascular diseases and infectious diseases. Furthermore, the present invention is directed towards pharmaceutical compositions containing at least one of the pyrazolo[1,5-a][1,3,5]triazine and pyrazolo[1,5-a]pyrimidine derivatives and/or pharmaceutically acceptable salts thereof.
