22868-76-4 Usage
Uses
Used in Nucleic Acid Synthesis:
Pyrimidine, 2,5-dimethyl(6CI,8CI,9CI) is used as a building block for the synthesis of nucleic acids such as DNA and RNA. Its unique structure allows it to be incorporated into the backbone of these genetic materials, contributing to their stability and function.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Pyrimidine, 2,5-dimethyl(6CI,8CI,9CI) is used as a key intermediate in the synthesis of various drugs. Its presence in the molecular structure of these compounds can influence their pharmacological properties, such as potency, selectivity, and bioavailability.
Used in Agrochemical Industry:
Pyrimidine, 2,5-dimethyl(6CI,8CI,9CI) is also utilized in the agrochemical industry for the development of pesticides and herbicides. Its incorporation into these chemical compounds can enhance their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Research and Development:
In research and development, Pyrimidine, 2,5-dimethyl(6CI,8CI,9CI) serves as a valuable compound for studying the structure and function of various biological molecules. Its unique properties allow scientists to explore its interactions with other molecules, leading to a better understanding of biological processes and the development of novel therapeutic agents.
Used in Manufacturing Processes:
In manufacturing processes, Pyrimidine, 2,5-dimethyl(6CI,8CI,9CI) is employed as a raw material for the production of various chemical compounds and materials. Its versatility and reactivity make it suitable for a wide range of applications, from the synthesis of pharmaceuticals to the development of advanced materials with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 22868-76-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,8,6 and 8 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 22868-76:
(7*2)+(6*2)+(5*8)+(4*6)+(3*8)+(2*7)+(1*6)=134
134 % 10 = 4
So 22868-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2/c1-5-3-7-6(2)8-4-5/h3-4H,1-2H3
22868-76-4Relevant articles and documents
Vapor phase phototransposition chemistry of dimethylpyrazines and dimethylpyrimidines
Pavlik, James W.,Vongakorn, Tharinee,Kebede, Naod
, p. 216 - 228 (2017/11/17)
Based on their phototransposition chemistry, the three dimethylpyrazines and four dimethylpyrimidines can be arranged into two groups. 2,5-Dimethylpyrazine, 2,5-dimethylpyrimidine, and 4,6-dimethylpyrimidine constitute a photochemical triad. Irradiation of any one member of the triad in the vapor phase results in the formation of the other two members. The other four isomers, 2,6-dimethylpyrazine, 2,3-dimethylpyrazine, 2,4- dimethylpyrimidine, and 4,5-dimethylpyrimidine constitute a photochemical tetrad. Irradiation of any one member results in the formation of the other three. In addition, 2,4-dimethylpyrimidine and 2,6-dimethylpyrazine also photoisomerize to 3,6-dimethylpyridazine. Irradiation of the last in the vapor state resulted in the four members of the tetrad.
