27688-85-3 Usage
Uses
Used in Pharmaceutical Industry:
[3,4-bis(phenylmethoxy)phenyl] acetate is used as a building block for the synthesis of various organic compounds, contributing to the development of new pharmaceutical products. Its unique chemical structure allows for the creation of innovative drugs with potential therapeutic benefits.
Used in Materials Science:
In the field of materials science, [3,4-bis(phenylmethoxy)phenyl] acetate is utilized as a starting material for the production of complex molecules and advanced materials. Its properties make it suitable for specific chemical reactions, enabling the development of novel materials with enhanced characteristics.
Used in Organic Chemistry:
[3,4-bis(phenylmethoxy)phenyl] acetate serves as an essential component in organic chemistry, where it is employed in the synthesis of a wide range of organic compounds. Its unique structure and reactivity make it a valuable asset in the development of new chemical products and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 27688-85-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,6,8 and 8 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 27688-85:
(7*2)+(6*7)+(5*6)+(4*8)+(3*8)+(2*8)+(1*5)=163
163 % 10 = 3
So 27688-85-3 is a valid CAS Registry Number.
InChI:InChI=1/C22H20O4/c1-17(23)26-20-12-13-21(24-15-18-8-4-2-5-9-18)22(14-20)25-16-19-10-6-3-7-11-19/h2-14H,15-16H2,1H3
27688-85-3Relevant articles and documents
Total Synthesis of Wedelolactone
Li, Chuang Chuang,Xie, Zhi Xiang,Zhang, Yan Dong,Chen, Jia Hua,Yang, Zhen
, p. 8500 - 8504 (2007/10/03)
The total synthesis of wedelolactone, a naturally occurring direct inhibitor of IKK complex that can suppress LPS-induced caspase-11 expression, using a convergent synthetic approach, is described. The key steps involved in this synthesis include the palladium-catalyzed Sonogashira reaction and the palladium-catalyzed carbonylative annulation reaction. This approach allows access to diversified analogues of wedelolactone.