352547-75-2 Usage
Uses
Used in Pharmaceutical Industry:
2-(2-Oxocyclohexyl)-2-hydroxy-acetic acid methyl ester is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-(2-Oxocyclohexyl)-2-hydroxy-acetic acid methyl ester is employed as a precursor for the production of agrochemicals, such as pesticides and herbicides. Its reactivity and volatility make it suitable for use in formulations that require controlled release or targeted application.
Used as a Solvent:
2-(2-Oxocyclohexyl)-2-hydroxy-acetic acid methyl ester is used as a solvent in various chemical processes due to its ability to dissolve a wide range of substances. Its volatility can be advantageous in applications where rapid evaporation is desired, such as in coating or adhesive formulations.
Used as a Synthesis Intermediate:
2-(2-Oxocyclohexyl)-2-hydroxy-acetic acid methyl ester serves as an intermediate in the synthesis of other chemical compounds, particularly in the production of specialty chemicals and fine chemicals. Its versatility in chemical reactions makes it a valuable building block for creating complex molecules with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 352547-75-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,4 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 352547-75:
(8*3)+(7*5)+(6*2)+(5*5)+(4*4)+(3*7)+(2*7)+(1*5)=152
152 % 10 = 2
So 352547-75-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H14O4/c1-13-9(12)8(11)6-4-2-3-5-7(6)10/h6,8,11H,2-5H2,1H3
352547-75-2Relevant articles and documents
A 2 - (2-hydroxy-phenyl) - 2-phenoxyacetic acid ester synthetic method
-
Paragraph 0058; 0059; 0060; 0061, (2016/11/09)
The invention discloses a synthetic method for 2-(2-hydroxyphenyl)-2-oxyacetate. The method comprises the following steps: taking cyclohexanone and glyoxylate as raw materials, producing an Aldol condensation reaction through catalysis at a room temperatu
Aqueous organocatalyzed aldol reaction of glyoxylic acid for the enantioselective synthesis of α-hydroxy-γ-keto acids
Moles, Fernando J. N.,Guillena, Gabriela,Najera, Carmen
, p. 9963 - 9966 (2014/03/21)
N-Tosyl-(Sa)-binam-l-prolinamide is an efficient catalyst for the aqueous aldol reaction, between glyoxylic acid, as monohydrate or aqueous solution, and ketones. This reaction led to the formation of chiral α-hydroxy-γ-keto carboxylic acids in
