474554-45-5 Usage
Uses
Used in Pharmaceutical Industry:
1,2-Benzenedicarbonitrile, 4,5-diethoxy-3-fluorois used as an intermediate in the production of pharmaceuticals. Its unique chemical structure allows it to be a key component in the synthesis of various drug molecules, contributing to the development of new medications.
Used in Agrochemical Industry:
1,2-Benzenedicarbonitrile, 4,5-diethoxy-3-fluorois also utilized as an intermediate in the production of agrochemicals. Its properties make it suitable for the synthesis of various agrochemical products, such as pesticides and herbicides, which are essential for agricultural applications.
Used in Medicinal Chemistry and Drug Discovery:
1,2-Benzenedicarbonitrile, 4,5-diethoxy-3-fluorohas potential applications in the field of medicinal chemistry and drug discovery. Its unique structure and properties make it a promising candidate for the development of new therapeutic agents and the advancement of drug discovery research.
Safety Precautions:
It is important to handle 1,2-Benzenedicarbonitrile, 4,5-diethoxy-3-fluorowith care, as it may pose certain health and safety risks if not handled properly. Appropriate safety measures should be taken during its production, storage, and use to minimize any potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 474554-45-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,4,5,5 and 4 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 474554-45:
(8*4)+(7*7)+(6*4)+(5*5)+(4*5)+(3*4)+(2*4)+(1*5)=175
175 % 10 = 5
So 474554-45-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H11FN2O2/c1-3-16-10-5-8(6-14)9(7-15)11(13)12(10)17-4-2/h5H,3-4H2,1-2H3
474554-45-5Relevant articles and documents
PROCESS FOR THE PRODUCTION OF ISOINDOLE DERIVATIVES
-
Page/Page column 8, (2008/06/13)
The present invention relates to a method for producing an isoindole derivative (compound (II)) with the following general formula (II): epImage id=""ia01"" he=""25"" wi=""59"" file=""imga0001.tif"" img-content=""chem"" img-format=""tif"" orientation=""p
2-IMINOPYRROLIDINE DERIVATES
-
Page 103, (2008/06/13)
A 2-iminopyrrolidine derivative represented by the formula: {wherein ring B represents a benzene ring, pyridine ring, etc.; R101 - R103 represent hydrogen, halogen, C1-6 alkyl, etc.; R5 represents hydrogen, C1-6 alkyl, C1-6 alkoxy-C1-6 alkyl, etc.; R6 represents hydrogen, C1-6 alkyl, C1-6 alkyloxycarbonyl, etc.; Y1 represents a single bond, -CH2-, etc.; Y2 represents a single bond, -CO-, etc.; and Ar represents hydrogen, a group represented by the formula: [wherein R10-R14 represent hydrogen, C1-6 alkyl, hydroxyl, C1-6 alkoxy, etc.; and R11 and R12 or R12 and R13 may bond together to form a 5- to 8-membered heterocyclic ring], etc.}, or a salt thereof.
