475060-21-0 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Acetamido-5-fluoro-4-picoline is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the formation of complex molecular structures. Its presence of functional groups allows for further chemical reactions and modifications, making it a valuable component in drug development.
Used in Organic Chemistry Research:
In the field of organic chemistry, 2-Acetamido-5-fluoro-4-picoline is used as a research compound to explore new reaction pathways and mechanisms. Its unique structure provides opportunities for studying the effects of fluorination and the interaction of different functional groups in organic molecules.
Used in Material Science:
2-Acetamido-5-fluoro-4-picoline may also find applications in material science, where its molecular structure could be utilized to develop new materials with specific properties. The fluoro and picoline groups could potentially influence the material's reactivity, stability, or other characteristics, making it a candidate for further investigation in this field.
Safety Considerations:
Due to its complex molecular structure and potential reactivity, 2-Acetamido-5-fluoro-4-picoline's handling and storage should follow the standards for hazardous materials. Further details such as specific physical properties, toxicity, and reactivity would need to be evaluated or researched in the context of specific tasks or applications to ensure safe and effective use.
Check Digit Verification of cas no
The CAS Registry Mumber 475060-21-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,5,0,6 and 0 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 475060-21:
(8*4)+(7*7)+(6*5)+(5*0)+(4*6)+(3*0)+(2*2)+(1*1)=140
140 % 10 = 0
So 475060-21-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9FN2O/c1-5-3-8(11-6(2)12)10-4-7(5)9/h3-4H,1-2H3,(H,10,11,12)
475060-21-0Relevant articles and documents
MexAB-OprM specific efflux pump inhibitors in Pseudomonas aeruginosa. Part 4: Addressing the problem of poor stability due to photoisomerization of an acrylic acid moiety
Nakayama, Kiyoshi,Kuru, Noriko,Ohtsuka, Masami,Yokomizo, Yoshihiro,Sakamoto, Atsunobu,Kawato, Haruko,Yoshida, Ken-Ichi,Ohta, Toshiharu,Hoshino, Kazuki,Akimoto, Katsuya,Itoh, Junko,Ishida, Hiroko,Cho, Aesop,Palme, Monica H.,Zhang, Jason Z.,Lee, Ving J.,Watkins, William J.
, p. 2493 - 2497 (2007/10/03)
Exchange of the ethylene tether in a series of pyridopyrimidine-based MexAB-OprM specific efflux pump inhibitors to an amide bond stabilized the olefin of the acrylic acid moiety, preventing facile photoisomerization to the Z-isomer. Furthermore, the activity was drastically improved in the amide tether variants, providing extremely potent acrylic acid and vinyl tetrazole analogues.
Drug efflux pump inhibitor
-
, (2008/06/13)
A medicament for preventive and/or therapeutic treatment of a microbial infection which comprises as an active ingredient a compound represented by the following general formula (I): wherein, R1 and R2 represent hydrogen atom, a halogen atom, hydroxyl group or the like, W1 represents —CH═CH—, —CH2O—, —CH2CH2— or the like; R3 represents hydrogen atom, a halogen atom, hydroxyl group or an amino group; R4 represents hydrogen atom, a group of —OZ0-4R5 (Z0-4 represents an alkylene group, a fluorine-substituted alkylene group or a single bond, and R5 represents a cyclic alkyl group, an aryl group or the like); W2 represents a single bond or —C(R8)═C(R9)— (R8 and R9 represent hydrogen atom, a halogen atom, a lower alkyl group or the like, Q represents an acidic group, but W2 and Q may together form vinylidenethiazolidinedione or an equivalent heterocyclic ring; m and n represent an integer of 0 to 2, and q represents an integer of 0 to 3.
