837364-89-3 Usage
Uses
Used in Organic Synthesis:
2,4-Difluoro-5-iodo-pyridine is utilized as a key intermediate in the synthesis of various organic compounds. Its unique structure and reactivity allow for the formation of new chemical bonds and the creation of diverse molecular architectures. This makes it a valuable building block in the development of novel organic molecules with potential applications in various fields.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2,4-difluoro-5-iodo-pyridine serves as a crucial component in the design and synthesis of new drug candidates. Its presence in the molecular structure can impart specific biological activities and properties, such as improved pharmacokinetics, enhanced target selectivity, and increased potency. Researchers leverage its reactivity to modify and optimize the pharmacological profiles of drug molecules, leading to the discovery of innovative therapeutic agents.
Used in Chemical Reactions:
Due to its high stability and high boiling point, 2,4-difluoro-5-iodo-pyridine is employed in specific chemical reactions that require such properties. It can act as a reactant, catalyst, or solvent in various processes, facilitating the formation of desired products and improving the overall efficiency of the reactions. Its unique combination of fluorine and iodine atoms also enables it to participate in unique chemical transformations, expanding the scope of synthetic methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 837364-89-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,7,3,6 and 4 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 837364-89:
(8*8)+(7*3)+(6*7)+(5*3)+(4*6)+(3*4)+(2*8)+(1*9)=203
203 % 10 = 3
So 837364-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H2F2IN/c6-3-1-5(7)9-2-4(3)8/h1-2H
837364-89-3Relevant articles and documents
Regiochemically flexible substitutions of di-, tri-, and tetrahalopyridines: The trialkylsilyl trick
Schlosser, Manfred,Bobbio, Carla,Rausis, Thierry
, p. 2494 - 2502 (2007/10/03)
(Chemical Equation Presented) 2,4-Difluoropyridine, 2,4-dichloropyridine, 2,4,6-trifluoropyridine, 2,4,6-trichloropyridine and 2,3,4,6-tetrafluoropyridine react with standard nucleophiles exclusively at the 4-position under halogen displacement. However, the regioselectivity can be completely reversed if a trialkylsilyl group is introduced in the 5-position of the 2,4-dihalopyridines or in the 3-position of the 2,4,6-trihalopyridines or 2,3,4,6-tetrahalopyridine. Then only the halogen most remote from the bulky silyl unit (at the 2-position in the case of the 2,4-halopyridines, at the 6-position with the other substrates) gets involved in the exchange process. After removal of the silyl protective group the nucleophile is invariably found to occupy the nitrogen-neighboring position.
Rerouting nucleophilic substitution from the 4-position to the 2- or 6-position of 2,4-dihalopyridines and 2,4,6-trihalopyridines: The solution to a long-standing problem
Schlosser, Manfred,Rausis, Thierry,Bobbio, Carla
, p. 127 - 129 (2007/10/03)
(Chemical Equation Presented) 2,4-Difluoro-, 2,4,6-trifluoro-, and 2,3,4,6-tetrafluoropyridine undergo nucleophilic substitution preferentially if not exclusively at the 4-position. However, after the introduction of a trialkylsilyl group at C-3 or C-5, t
