855153-75-2 Usage
Uses
Used in Pharmaceutical Industry:
2-PIPERIDIN-1-YLISONICOTIC ACID 97% is used as a building block for the synthesis of various pharmaceuticals and agrochemicals, contributing to the development of new drugs and improving the efficacy of existing ones.
2-PIPERIDIN-1-YLPYRIDIN-4-YLCARBOXYLIC ACID is used as a key intermediate in the synthesis of pharmaceutical compounds, playing a crucial role in the production of various drugs and enhancing their therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 855153-75-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,5,1,5 and 3 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 855153-75:
(8*8)+(7*5)+(6*5)+(5*1)+(4*5)+(3*3)+(2*7)+(1*5)=182
182 % 10 = 2
So 855153-75-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O2/c14-11(15)9-4-5-12-10(8-9)13-6-2-1-3-7-13/h4-5,8H,1-3,6-7H2,(H,14,15)
855153-75-2Relevant articles and documents
Benzothiazole Formulations and Use Thereof
-
Page/Page column 25, (2010/11/30)
The present invention is related to macrogol glyceride pharmaceutical formulations containing benzothiazole derivatives. In particular, the invention is related to benzothiazole stearoyl macrogol pharmaceutical formulations, method of preparation and use thereof.
