1000339-23-0 Usage
Uses
Used in Chemical Research:
2-Amino-5-bromoisonicotinic acid is used as a research compound for its unique properties and reactivity in chemical reactions. Its bromo and amino substituents allow for versatile interactions, making it a valuable building block in the synthesis of various chemical compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-Amino-5-bromoisonicotinic acid is utilized as an advanced intermediate in the development of complex molecules with potential therapeutic applications. Its unique structure and reactivity contribute to the design and synthesis of novel drug candidates.
Used in Synthesis Processes:
2-Amino-5-bromoisonicotinic acid is employed as a precursor in various synthesis processes, where its bromo and amino substituents enable the formation of new chemical entities. Its utility in these processes highlights its importance in the creation of innovative compounds with diverse applications.
It is important to handle 2-Amino-5-bromoisonicotinic acid with care due to potential risks upon contact or ingestion, as with many chemicals. Its applications in research and synthesis underscore its significance in the development of new chemical and pharmaceutical products.
Check Digit Verification of cas no
The CAS Registry Mumber 1000339-23-0 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,0,0,3,3 and 9 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1000339-23:
(9*1)+(8*0)+(7*0)+(6*0)+(5*3)+(4*3)+(3*9)+(2*2)+(1*3)=70
70 % 10 = 0
So 1000339-23-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrN2O2/c7-4-2-9-5(8)1-3(4)6(10)11/h1-2H,(H2,8,9)(H,10,11)
1000339-23-0Relevant articles and documents
INHIBITORS OF HEPATITIS C VIRUS
-
Page/Page column 145, (2012/05/19)
A class of compounds that inhibit Hepatitis C Virus (HCV) is disclosed, along with compositions containing the compound, and methods of using the composition for treating individuals infected with HCV.
