3589-45-5 Usage
Description
N-(2-Cyanoethyl)-phthalimide, a chemical compound with the formula C10H7NO2, is a phthalimide derivative featuring a cyanoethyl group. N-(2-CYANOETHYL)-PHTHALIMIDE is known for its utility in the synthesis of pharmaceuticals and organic compounds, owing to its chemical structure and properties that facilitate the addition of cyanoethyl groups to other organic molecules. Additionally, it serves as a building block in the production of dyes, pigments, and specialty chemicals. Careful handling and storage are essential due to potential health and environmental risks.
Uses
Used in Pharmaceutical Synthesis:
N-(2-Cyanoethyl)-phthalimide is used as a reagent for the synthesis of various pharmaceuticals and organic compounds. Its unique structure allows for the addition of cyanoethyl groups to other molecules, which is crucial in the creation of new drug candidates and organic materials.
Used in Dye and Pigment Production:
N-(2-CYANOETHYL)-PHTHALIMIDE is utilized as a building block in the production of dyes and pigments, contributing to the development of a wide range of colorants used in various industries.
Used in Specialty Chemicals Manufacturing:
N-(2-Cyanoethyl)-phthalimide is also employed in the manufacturing of specialty chemicals, where its specific chemical properties are leveraged to create high-value products for niche applications.
Safety Precautions:
Given the potential health and environmental risks associated with N-(2-Cyanoethyl)-phthalimide, it is imperative to handle and store this compound with proper safety measures to mitigate any adverse effects.
Check Digit Verification of cas no
The CAS Registry Mumber 3589-45-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,5,8 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 3589-45:
(6*3)+(5*5)+(4*8)+(3*9)+(2*4)+(1*5)=115
115 % 10 = 5
So 3589-45-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N2O2/c12-6-3-7-13-10(14)8-4-1-2-5-9(8)11(13)15/h1-2,4-5H,3,7H2