867130-58-3 Usage
Uses
Used in Pharmaceutical Industry:
6-oxo-1,6-dihydropyridazine-4-carboxylic acid is used as a key intermediate in the synthesis of pharmaceuticals for its ability to be incorporated into the molecular structures of various drugs. Its presence in the molecular framework can contribute to the development of new therapeutic agents with improved pharmacological properties.
Used in Agrochemical Industry:
In the agrochemical sector, 6-oxo-1,6-dihydropyridazine-4-carboxylic acid is utilized as a precursor in the development of agrochemicals, such as pesticides and herbicides. Its chemical properties allow for the creation of compounds that can effectively control pests and weeds, thereby enhancing crop protection and yield.
Used in Materials Science:
6-oxo-1,6-dihydropyridazine-4-carboxylic acid is employed as a building block in the synthesis of functional materials with specific properties. Its incorporation into the molecular structure of these materials can lead to the development of advanced materials with applications in various fields, such as electronics, sensors, and energy storage.
Used in Organic Synthesis:
As a versatile chemical intermediate, 6-oxo-1,6-dihydropyridazine-4-carboxylic acid is used in organic synthesis to create a wide range of organic compounds. Its reactive functional groups facilitate various chemical reactions, enabling the synthesis of complex molecules with diverse applications in research and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 867130-58-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,7,1,3 and 0 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 867130-58:
(8*8)+(7*6)+(6*7)+(5*1)+(4*3)+(3*0)+(2*5)+(1*8)=183
183 % 10 = 3
So 867130-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N2O3/c8-4-1-3(5(9)10)2-6-7-4/h1-2H,(H,7,8)(H,9,10)
