Products Categories
| CAS No.: | 115610-29-2 |
|---|---|
| Name: | CAPE |
| Molecular Structure: | |
|
|
|
| Formula: | C17H16O4 |
| Molecular Weight: | 284.312 |
| Synonyms: | 2-Propenoicacid, 3-(3,4-dihydroxyphenyl)-, 2-phenylethyl ester, (E)-;(E)-Caffeic acid phenethylester; |
| Density: | 1.266 /cm3 |
| Melting Point: | 121-123 °C |
| Boiling Point: | 498.6 °C at 760 mmHg |
| Flash Point: | 185.1 °C |
| Hazard Symbols: | R36/37/38:; |
| Risk Codes: | Xi:Irritant; "> |
| PSA: | 66.76000 |
| LogP: | 2.89690 |
The Cape, with the CAS registry number 115610-29-2, is also known as 2-Propenoic acid, 3-(3,4-dihydroxyphenyl)-, 2-phenylethyl ester, (E)- and Phenethyl caffeiate. This chemical's molecular formula is C17H16O4 and molecular weight is 284.31. Its IUPAC name and systematic name are the same which is called Phenethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
Physical properties about Cape are: (1)ACD/LogP: 3.38; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.38; (4)ACD/LogD (pH 7.4): 3.37; (5)ACD/BCF (pH 5.5): 218.39; (6)ACD/BCF (pH 7.4): 214.43; (7)ACD/KOC (pH 5.5): 1644.38; (8)ACD/KOC (pH 7.4): 1614.58; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 8; (12)Polar Surface Area: 44.76 Å2; (13)Index of Refraction: 1.645; (14)Molar Refractivity: 81.43 cm3; (15)Molar Volume: 224.4 cm3; (16)Surface Tension: 56.9 dyne/cm; (17)Density: 1.266 g/cm3; (18)Flash Point: 185.1 °C; (19)Enthalpy of Vaporization: 79.59 kJ/mol; (20)Boiling Point: 498.6 °C at 760 mmHg; (21)Vapour Pressure: 1.45E-10 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: O=C(OCCc1ccccc1)\C=C\c2cc(O)c(O)cc2
(2)InChI: InChI=1/C17H16O4/c18-15-8-6-14(12-16(15)19)7-9-17(20)21-11-10-13-4-2-1-3-5-13/h1-9,12,18-19H,10-11H2/b9-7+
(3)InChIKey: SWUARLUWKZWEBQ-VQHVLOKHBT