This chemical is called Cefditoren sodium, and it's also named as -azabicyclo[4.2.0]oct-2-ene-2-carboxylicacid,7-[[(2Z)-2-(2-amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-[(1Z)-2-(4-methyl-5-thiazolyl)ethenyl]-8-oxo-,sodium salt (1:1), (6R,7R)-. With the molecular formula of C₁₉H₁₇N₆NaO₅S₃, its molecular weight is 528.56. The CAS registry number of this chemical is 104146-53-4. Additionally, its classification code is Drug / Therapeutic Agent.

Other characteristics of the Cefditoren sodium can be summarised as followings: (1)ACD/LogP: 1.48; (2)# of Rule of 5 Violations: 2; (3)ACD/LogD (pH 5.5): -1; (4)ACD/LogD (pH 7.4): -2; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 11; (10)#H bond donors: 4.

You can still convert the following datas into molecular structure:
1.SMILES: [Na+].O=C3N2/C(=C(/C=C/c1scnc1C)CS[C@@H]2[C@@H]3NC(=O)C(=N\OC)\c4nc(sc4)N)C(=O)O
2.InChI: InChI=1/C19H18N6O5S3.Na/c1-8-11(33-7-21-8)4-3-9-5-31-17-13(16(27)25(17)14(9)18(28)29)23-15(26)12(24-30-2)10-6-32-19(20)22-10;/h3-4,6-7,13,17H,5H2,1-2H3,(H2,20,22)(H,23,26)(H,28,29);/q;+1/b4-3+,24-12+;/t13-,17-;/m1./s1
3.InChIKey: VFUMWBZIKOREOO-ZSCWKNKWBF

The toxicity data is as follows: