Products Categories
| CAS No.: | 9035-69-2 |
|---|---|
| Name: | Cellulose diacetate |
| Molecular Structure: | |
|
|
|
| Formula: | C2H4O2 |
| Molecular Weight: | 0 |
| Synonyms: | Cellulose diacetate;acetate tow;ACETIC ACID, GLACIAL, USP 64-19-7 |
| Density: | 1.068g/cm3 |
| Melting Point: | 16.6oC |
| Boiling Point: | 117.1°Cat760mmHg |
| Flash Point: | 40°C |
| PSA: | 0.00000 |
| LogP: | 3.56800 |
Molecular Structure of Cellulose diacetate (CAS No.9035-69-2):

Molecular Formula: C2H4O2
Molecular Weight: 60.052
CAS No: 9035-69-2
IUPAC Name: Acetic acid
H bond acceptors: 2
H bond donors: 1
Freely Rotating Bonds: 0
Polar Surface Area: 26.3 Å2
Index of Refraction: 1.375
Molar Refractivity: 12.87 cm3
Molar Volume: 56.1 cm3
Surface Tension: 31.9 dyne/cm
Density: 1.068 g/cm3
Flash Point: 40 °C
Enthalpy of Vaporization: 23.7 kJ/mol
Boiling Point: 117.1 °C at 760 mmHg
Vapour Pressure: 13.9 mmHg at 25°C
InChI: InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)
InChIKey: QTBSBXVTEAMEQO-UHFFFAOYAR
Cellulose diacetate (CAS No.9035-69-2), its synonyms are Acetic acid ; Acid, Acetic ; Acide acétique .