Products Categories
| CAS No.: | 71957-08-9 |
|---|---|
| Name: | COBALT GLUCONATE |
| Molecular Structure: | |
|
|
|
| Formula: | C12H22CoO14 |
| Molecular Weight: | 449.23 |
| Synonyms: | D-Gluconic acid, cobalt complex;Cobalt(2+)gluconate; |
| EINECS: | 276-206-1 |
| Melting Point: | >300 °C |
| Boiling Point: | 673.6 °C at 760 mmHg |
| Flash Point: | 375.1 °C |
| Hazard Symbols: | Xn |
| Risk Codes: | 20/21/22 |
| Safety: | 22-36/37/39 |
| PSA: | 248.58000 |
| LogP: | -6.26400 |
This chemical is called Bis(D-gluconato-O1,O2)cobalt. With the molecular formula of C12H22CoO14, its molecular weight is 449.23. The CAS registry number of this chemical is 71957-08-9.
Other characteristics of the Bis(D-gluconato-O1,O2)cobalt can be summarised as followings: (1)ACD/LogP: -3.18; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): -5.88; (4)ACD/LogD (pH 7.4): -6.87; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 7; (10)#H bond donors: 6; (11)#Freely Rotating Bonds: 10; (12)Polar Surface Area: 83.45 Å2; (13)Flash Point: 375.1 °C; (14)Enthalpy of Vaporization: 113.2 kJ/mol; (15)Boiling Point: 673.6 °C at 760 mmHg; (16)Vapour Pressure: 4.95E-21 mmHg at 25°C.
When you are using this chemical, please be cautious about it as the following: This chemical is harmful by inhalation, in contacting with skin and if swallowed. Do not breathe dust. Wear suitable protective clothing, gloves and eye/face protection.
You can still convert the following datas into molecular structure:
1.SMILES: [Co+2].[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
2.InChI: InChI=1/2C6H12O7.Co/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1
3.InChIKey: BMJZVKPTRWYLKB-QFKJHGNTBW