The Copper, bis[2-(hydroxy-kO)propanoato-kO]- with CAS registry number of 16039-52-4 is also known as Copper lactate. The IUPAC name is Copper 2-hydroxypropanoate. Its EINECS registry number is 240-177-3. In addition, the formula is C₆H₁₀CuO₆ and the molecular weight is 241.69.

Physical properties about Copper, bis[2-(hydroxy-kO)propanoato-kO]- are: (1)ACD/LogP: -0.70; (2)ACD/LogD (pH 5.5): -2.76; (3)ACD/LogD (pH 7.4): -4.24; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 2; (11)Flash Point: 109.9 °C; (12)Enthalpy of Vaporization: 53.96 kJ/mol; (13)Boiling Point: 227.6 °C at 760 mmHg; (14)Vapour Pressure: 0.015 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: CC(C(=O)[O-])O.CC(C(=O)[O-])O.[Cu+2]
2. InChI: InChI=1S/2C3H6O3.Cu/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2
3. InChIKey: DYROSKSLMAPFBZ-UHFFFAOYSA-L