The D-Xylonic acid, gamma-lactone, with the CAS registry number 15384-37-9, is also known as D-xylono-1,4-lactone. This chemical's molecular formula is C₅H₈O₅ and molecular weight is 148.11402. Its IUPAC name is called (3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one.

Physical properties of D-Xylonic acid, gamma-lactone: (1)ACD/LogP: -2.47; (2)#H bond acceptors: 5; (3)#H bond donors: 3; (4)#Freely Rotating Bonds: 4; (5)Index of Refraction: 1.58; (6)Molar Refractivity: 29.59 cm³; (7)Molar Volume: 88.8 c^m3; (8)Surface Tension: 86.7 dyne/cm; (9)Density: 1.667 g/cm³; (10)Flash Point: 162.8 °C; (11)Enthalpy of Vaporization: 70.66 kJ/mol; (12)Boiling Point: 364.3 °C at 760 mmHg; (13)Vapour Pressure: 8.77E-07 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C(C1C(C(C(=O)O1)O)O)O
(2)Isomeric SMILES: C([C@@H]1[C@@H]([C@H](C(=O)O1)O)O)O
(3)InChI: InChI=1S/C5H8O5/c6-1-2-3(7)4(8)5(9)10-2/h2-4,6-8H,1H2/t2-,3+,4-/m1/s1
(4)InChIKey: CUOKHACJLGPRHD-FLRLBIABSA-N