The Decanoic acid,3-hydroxy-, with the CAS registry number 14292-26-3, is also known as beta-Hydroxydecanoic acid. This chemical's molecular formula is C₁₀H₂₀O₃ and molecular weight is 188.26. Its IUPAC name is called 3-Hydroxydecanoic acid.

Physical properties of Decanoic acid,3-hydroxy-: (1)ACD/LogP: 2.05; (2)ACD/LogD (pH 5.5): 0.82; (3)ACD/LogD (pH 7.4): -0.97; (4)ACD/BCF (pH 5.5): 1.24; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 18.12; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 9; (11)Index of Refraction: 1.464; (12)Molar Refractivity: 51.43 cm³; (13)Molar Volume: 186.1 cm³; (14)Surface Tension: 39.2 dyne/cm; (15)Density: 1.011 g/cm³; (16)Flash Point: 160.5 °C; (17)Enthalpy of Vaporization: 64.88 kJ/mol; (18)Boiling Point: 318.2 °C at 760 mmHg; (19)Vapour Pressure: 3.03E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCCCCCCC(CC(=O)O)O
(2)InChI: InChI=1S/C10H20O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h9,11H,2-8H2,1H3,(H,12,13)
(3)InChIKey: FYSSBMZUBSBFJL-UHFFFAOYSA-N