The Ethanone,1-(4-pentylphenyl)-, oxime, with the CAS registry number 64128-28-5, is also known as 1-(4-Pentylphenyl)ethan-1-one oxime. This chemical's molecular formula is C₁₃H₁₉NO and molecular weight is 205.2961. Its systematic name is called (1E)-1-(4-pentylphenyl)ethanone oxime.

Physical properties of Ethanone,1-(4-pentylphenyl)-, oxime: (1)ACD/LogP: 4.25; (2)#H bond acceptors: 2; (3)#H bond donors: 1; (4)#Freely Rotating Bonds: 6; (5)Index of Refraction: 1.505; (6)Molar Refractivity: 63.44 cm³; (7)Molar Volume: 213.6 cm³; (8)Surface Tension: 32.9 dyne/cm; (9)Density: 0.96 g/cm³; (10)Flash Point: 196.3 °C; (11)Enthalpy of Vaporization: 59.41 kJ/mol; (12)Boiling Point: 321 °C at 760 mmHg; (13)Vapour Pressure: 0.000127 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O\N=C(\c1ccc(cc1)CCCCC)C
(2)InChI: InChI=1/C13H19NO/c1-3-4-5-6-12-7-9-13(10-8-12)11(2)14-15/h7-10,15H,3-6H2,1-2H3/b14-11+
(3)InChIKey: WMBIDOSUXWMCSJ-SDNWHVSQBE