The Ethyl 2-oxo-2-[3-(trifluoromethyl)anilino]acetate is an organic compound with the formula C₁₁H₁₀F₃NO₃. The systematic name of this chemical is ethyl oxo{[3-(trifluoromethyl)phenyl]amino}acetate. With the CAS registry number 17738-86-2, it is also named as acetic acid, 2-oxo-2-[[3-(trifluoromethyl)phenyl]amino]-, ethyl ester. In addition, the molecular weight is 261.2.

The other characteristics of Ethyl 2-oxo-2-[3-(trifluoromethyl)anilino]acetate can be summarized as: (1)ACD/LogP: 2.83; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.83; (4)ACD/LogD (pH 7.4): 2.83; (5)ACD/BCF (pH 5.5): 83.58; (6)ACD/BCF (pH 7.4): 83.54; (7)ACD/KOC (pH 5.5): 826.9; (8)ACD/KOC (pH 7.4): 826.53; (9)#H bond acceptors: 4; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 46.61 Å²; (13)Index of Refraction: 1.499; (14)Molar Refractivity: 56.54 cm³; (15)Molar Volume: 192.5 cm³; (16)Polarizability: 22.41×10^-24 cm³; (17)Surface Tension: 36.2 dyne/cm; (18)Density: 1.356 g/cm³.

People can use the following data to convert to the molecule structure.
1. SMILES:O=C(Nc1cc(ccc1)C(F)(F)F)C(=O)OCC
2. InChI:InChI=1/C11H10F3NO3/c1-2-18-10(17)9(16)15-8-5-3-4-7(6-8)11(12,13)14/h3-6H,2H2,1H3,(H,15,16)
3. InChIKey:UKPJCBWVGQNZSF-UHFFFAOYAM
4. Std. InChI:InChI=1S/C11H10F3NO3/c1-2-18-10(17)9(16)15-8-5-3-4-7(6-8)11(12,13)14/h3-6H,2H2,1H3,(H,15,16) 
5. Std. InChIKey:UKPJCBWVGQNZSF-UHFFFAOYSA-N