The Furo[2,3-b]pyridine-2-carboxylic acid, 5-nitro-, with the CAS registry number 6563-65-1, is also known as Furo[2,3-b]pyridine-2-carboxylic acid, 5-nitro-. This chemical's molecular formula is C₈H₄N₂O₅ and molecular weight is 208.1278. Its systematic name is called 5-nitrofuro[2,3-b]pyridine-2-carboxylic acid. 

Physical properties of Furo[2,3-b]pyridine-2-carboxylic acid, 5-nitro-: (1)ACD/LogP: 0.49; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 7; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 2; (9)Index of Refraction: 1.701; (10)Molar Refractivity: 47.962 cm³; (11)Molar Volume: 123.939 cm³; (12)Surface Tension: 85.471 dyne/cm; (13)Density: 1.679 g/cm³; (14)Flash Point: 204.727 °C; (15)Enthalpy of Vaporization: 70.42 kJ/mol; (16)Boiling Point: 414.904 °C at 760 mmHg; (17)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [O-][N+](=O)c1cc2cc(oc2nc1)C(O)=O
(2)InChI: InChI=1/C8H4N2O5/c11-8(12)6-2-4-1-5(10(13)14)3-9-7(4)15-6/h1-3H,(H,11,12)
(3)InChIKey: FKGYXJCDVVAPCX-UHFFFAOYAX